Tris(triethylsilyl)silane structure
|
Common Name | Tris(triethylsilyl)silane | ||
|---|---|---|---|---|
| CAS Number | 25436-74-2 | Molecular Weight | 373.89200 | |
| Density | 0.887 g/cm3 at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C18H45Si4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Tris(triethylsilyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.887 g/cm3 at 25 °C |
|---|---|
| Molecular Formula | C18H45Si4 |
| Molecular Weight | 373.89200 |
| Exact Mass | 373.26000 |
| LogP | 7.24190 |
| InChIKey | PSKAPVTWMJRNGQ-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)[Si]([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~51%
Tris(triethylsi... CAS#:25436-74-2 |
| Literature: Yamaoka, Yousuke; Yamamoto, Hisashi Journal of the American Chemical Society, 2010 , vol. 132, # 15 p. 5354 - 5356 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| tris(triethylsilyl)silicon |