chloro-tris(triethylsilyl)silane structure
|
Common Name | chloro-tris(triethylsilyl)silane | ||
|---|---|---|---|---|
| CAS Number | 30432-47-4 | Molecular Weight | 409.34500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H45ClSi4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | chloro-tris(triethylsilyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H45ClSi4 |
|---|---|
| Molecular Weight | 409.34500 |
| Exact Mass | 408.22900 |
| LogP | 7.93140 |
| InChIKey | PWDJKBJJIRTHAW-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)[Si](Cl)([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Supplemental HS | Contact with water liberates toxic gas. |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~%
chloro-tris(tri... CAS#:30432-47-4 |
| Literature: Buerger,H.; Kilian,W. Journal of Organometallic Chemistry, 1971 , vol. 26, p. 47 - 55 |
|
~%
chloro-tris(tri... CAS#:30432-47-4 |
| Literature: Buerger,H.; Kilian,W. Journal of Organometallic Chemistry, 1971 , vol. 26, p. 47 - 55 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Supersilyl TES |
| Chlorotris(triethylsilyl)silane |