Phenol,2-[[(2-hydroxy-1,1-dimethylethyl)imino]methyl]-4-nitro- structure
|
Common Name | Phenol,2-[[(2-hydroxy-1,1-dimethylethyl)imino]methyl]-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 25458-15-5 | Molecular Weight | 238.24000 | |
| Density | 1.27g/cm3 | Boiling Point | 358.4ºC at 760mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | (6E)-6-[[(1-hydroxy-2-methylpropan-2-yl)amino]methylidene]-4-nitrocyclohexa-2,4-dien-1-one |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 358.4ºC at 760mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24000 |
| Flash Point | 170.5ºC |
| Exact Mass | 238.09500 |
| PSA | 98.64000 |
| LogP | 2.01340 |
| Vapour Pressure | 1.41E-06mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | LFUQGVMMWIATOD-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)N=Cc1cc([N+](=O)[O-])ccc1O |
|
~%
Phenol,2-[[(2-h... CAS#:25458-15-5 |
| Literature: Billman; Koehler; May Journal of pharmaceutical sciences, 1969 , vol. 58, # 6 p. 767 - 769 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |