Dilithium phthalocyanine-29,30-diide
Dilithium phthalocyanine-29,30-diide structure
|
Common Name | Dilithium phthalocyanine-29,30-diide | ||
|---|---|---|---|---|
| CAS Number | 25510-41-2 | Molecular Weight | 526.405 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H16Li2N8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 113 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dilithium phthalocyanine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H16Li2N8 |
|---|---|
| Molecular Weight | 526.405 |
| Flash Point | 113 °C |
| Exact Mass | 526.181824 |
| PSA | 84.02000 |
| LogP | 1.46440 |
| InChIKey | HQQKMOJOCZFMSV-UHFFFAOYSA-N |
| SMILES | [Li+].[Li+].c1ccc2c(c1)-c1nc-2nc2[n-]c(nc3nc(nc4[n-]c(n1)c1ccccc41)-c1ccccc1-3)c1ccccc21 |
| Storage condition | 0-10°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H312-H315-H319-H332-H335-H360 |
| Precautionary Statements | P201-P261-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 61-20/21/22-36/37/38 |
| Safety Phrases | 24/25-45-36/37/39-22-53 |
| RIDADR | NONH for all modes of transport |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| LITHIUM PHTHALOCYANINE |
| PHTHALOCYANINE,LI |
| phthalocyaninato dilithium |
| Dilithium phthalocyanine-29,30-diide |
| PHTHALOCYANINE DILITHIUM |
| Phthalocyanine Dilithium (contains ca. 1-Pentanol) |
| PHTHALOCYANINE LITHIUM |
| DilithiuM Phthalocyanine |
| ithium phthalocyanine |
| Li2(phthalocyaninate) |
| 29H,30H-Phthalocyanine, lithium salt (1:2) |
| Dilithium Phthalocyanine(contains ca. 1-Pentanol) |
| MFCD00059094 |
| 29H,31H-Phthalocyanine dilithium salt |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Dilithium phthalocyanine? |
| A: The English name of Dilithium phthalocyanine is Dilithium phthalocyanine. |
| Q: What are the storage conditions for Dilithium phthalocyanine? |
| A: Storage conditions for Dilithium phthalocyanine: 0-10°C. |
| Q: What is the molecular weight of Dilithium phthalocyanine? |
| A: Molecular weight of Dilithium phthalocyanine is 526.405. |
| Q: What is the LogP of Dilithium phthalocyanine? |
| A: LogP of Dilithium phthalocyanine is 1.46440. |
| Q: What is the CAS number of Dilithium phthalocyanine? |
| A: CAS number of Dilithium phthalocyanine is 25510-41-2. |
| Q: What is the SMILES notation of Dilithium phthalocyanine? |
| A: SMILES notation of Dilithium phthalocyanine is [Li+].[Li+].c1ccc2c(c1)-c1nc-2nc2[n-]c(nc3nc(nc4[n-]c(n1)c1ccccc41)-c1ccccc1-3)c1ccccc21. |
| Q: What is the molecular formula of Dilithium phthalocyanine? |
| A: Molecular formula of Dilithium phthalocyanine is C32H16Li2N8. |
| Q: What is the polar surface area (PSA) of Dilithium phthalocyanine? |
| A: Polar surface area (PSA) of Dilithium phthalocyanine is 84.02000. |
| Q: What English synonyms does Dilithium phthalocyanine have? |
| A: English synonyms of Dilithium phthalocyanine: LITHIUM PHTHALOCYANINE, PHTHALOCYANINE,LI, phthalocyaninato dilithium, Dilithium phthalocyanine-29,30-diide, PHTHALOCYANINE DILITHIUM, Phthalocyanine Dilithium (contains ca. 1-Pentanol), PHTHALOCYANINE LITHIUM, DilithiuM Phthalocyanine, ithium phthalocyanine, Li2(phthalocyaninate), 29H,30H-Phthalocyanine, lithium salt (1:2), Dilithium Phthalocyanine(contains ca. 1-Pentanol), MFCD00059094, 29H,31H-Phthalocyanine dilithium salt. |
| Q: What is the InChIKey of Dilithium phthalocyanine? |
| A: InChIKey of Dilithium phthalocyanine is HQQKMOJOCZFMSV-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |