Isobutyryl-L-carnitine structure
|
Common Name | Isobutyryl-L-carnitine | ||
|---|---|---|---|---|
| CAS Number | 25518-49-4 | Molecular Weight | 231.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Isobutyryl-L-carnitineIsobutyryl-L-carnitine is a product of the acyl-CoA dehydrogenases. Isobutyryl-L-carnitine is a member of the class of compounds known as acyl carnitines. |
| Name | O-isobutyryl-L-carnitine |
|---|---|
| Synonym | More Synonyms |
| Description | Isobutyryl-L-carnitine is a product of the acyl-CoA dehydrogenases. Isobutyryl-L-carnitine is a member of the class of compounds known as acyl carnitines. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Molecular Formula | C11H21NO4 |
|---|---|
| Molecular Weight | 231.28900 |
| Exact Mass | 231.14700 |
| PSA | 66.43000 |
| InChIKey | LRCNOZRCYBNMEP-SECBINFHSA-N |
| SMILES | CC(C)C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| Storage condition | 2-8°C |
| 3-(Isobutyryloxy)-4-(trimethylammonio)butanoate |
| 4-Methyl-3-oxovaleric Acid Methyl Ester |
| isobutyrylacetic acid methyl ester |
| Iso-butyryl methyl acetate |
| Methyl isobutyrylacetate |
| O-i-Butyroylcarnitin |
| isobutyrylcarnitine |
| O-Isobutyryl-carnitin |
| i-Butyryl-l-Carnitin |
| 4-methyl-3-oxopentanoic acid methyl ester |
| IBEM |
| Methyl 4-methyl-3-oxovalerate |
| isobutyryl L-carnitine |