Acetyl-L-Carnitine Hydrochloride structure
|
Common Name | Acetyl-L-Carnitine Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5080-50-2 | Molecular Weight | 239.697 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18ClNO4 | Melting Point | 194 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Acetyl-L-Carnitine HydrochlorideAcetyl-L-carnitine hydrochloride is a blood-brain permeable acetyl ester of the amino acid L-carnitine found in the body. Acetyl-L-carnitine hydrochloride is often used as a dietary supplement, and exibits anti-stress-related psychiatric disorders[1]. |
| Name | o-Acetyl-L-carnitine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Acetyl-L-carnitine hydrochloride is a blood-brain permeable acetyl ester of the amino acid L-carnitine found in the body. Acetyl-L-carnitine hydrochloride is often used as a dietary supplement, and exibits anti-stress-related psychiatric disorders[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Melting Point | 194 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C9H18ClNO4 |
| Molecular Weight | 239.697 |
| Exact Mass | 239.092438 |
| PSA | 63.60000 |
| LogP | 0.90100 |
| Index of Refraction | -28 ° (C=1, H2O) |
| InChIKey | JATPLOXBFFRHDN-DDWIOCJRSA-N |
| SMILES | CC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
| Water Solubility | soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Candida rugosa lipase immobilization on hydrophilic charged gold nanoparticles as promising biocatalysts: Activity and stability investigations.
Colloids Surf. B Biointerfaces 131 , 93-101, (2015) In this work, a simple and versatile methodology to obtain two different bioconjugated systems has been developed by the immobilization of Candida rugosa lipase (CRL) on hydrophilic gold nanoparticles... |
|
|
Aerobic Fitness Affects the Exercise Performance Responses to Nitrate Supplementation.
Med. Sci Sports Exerc. 47 , 1643-51, (2015) Dietary nitrate supplementation has been shown to reduce O2 cost of submaximal exercise, improve exercise tolerance, and enhance performance in moderately trained individuals. In contrast, data have b... |
|
|
Development of a metabolomic radiation signature in urine from patients undergoing total body irradiation.
Radiat. Res. 181(4) , 350-61, (2014) The emergence of the threat of radiological terrorism and other radiological incidents has led to the need for development of fast, accurate and noninvasive methods for detection of radiation exposure... |
| (R)-3-Acetoxy-4-(trimethylammonio)butyrate Hydrochloride |
| (2R)-2-(Acetyloxy)-3-carboxy-N,N,N-trimethylpropan-1-aminium chloride |
| (R)-3-(Acetyloxy)-4-(trimethylammonio)butyrate hydrochloride |
| (3R)-3-(Acetyloxy)-4-(trimethylammonio)butanoate hydrochloride |
| MFCD00082230 |
| Acetyl-L-carnitine Hydrochloride |
| (3R)-3-(Acetyloxy)-4-(trimethylammonio)butyrate hydrochloride |
| (S)-3-Acetoxy-4-(trimethylammonio)butanoate hydrochloride |
| Acetylcarnitine chloride L- |
| Nicetile |
| (3R)-3-Acetoxy-4-(trimethylammonio)butanoate hydrochloride (1:1) |
| (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethylpropan-1-aminium chloride |
| O-Acetyl-L-carnitine HCl |
| 1-Propanaminium, 2-(acetyloxy)-3-carboxy-N,N,N-trimethyl-, chloride, (R)- |
| (R)-3-Acetoxy-4-(trimethylammonio)butyric acid hydrochloride |
| (R)-2-Acetyloxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride |
| (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethylpropan-1-aminiumchlorid |
| (R)-3-(Acetyloxy)-4-(trimethylammonio)butanoate hydrochloride |
| Acetyl-L-carnitine chloride |
| Acetylcarnitine |
| 1-Propanaminium, 2-(acetyloxy)-3-carboxy-N,N,N-trimethyl-, chloride, (2R)- (1:1) |
| Levacecarnine hydrochloride |
| (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride |
| O-Acetyl-L-carnitine hydrochloride |
| 1-Propanaminium, 2-(acetyloxy)-3-carboxy-N,N,N-trimethyl-, inner salt, (2R)-, hydrochloride (1:1) |