N-[(4-chlorophenyl)carbamoyl]-N-methylformamide structure
|
Common Name | N-[(4-chlorophenyl)carbamoyl]-N-methylformamide | ||
|---|---|---|---|---|
| CAS Number | 25546-06-9 | Molecular Weight | 212.63300 | |
| Density | 1.366g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-chlorophenyl)carbamoyl]-N-methylformamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.63300 |
| Exact Mass | 212.03500 |
| PSA | 49.41000 |
| LogP | 2.66900 |
| Index of Refraction | 1.61 |
| InChIKey | SIAQSJWZRNNRPJ-UHFFFAOYSA-N |
| SMILES | CN(C=O)C(=O)Nc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~47%
N-[(4-chlorophe... CAS#:25546-06-9 |
| Literature: Schweim, Harald G. Archiv der Pharmazie (Weinheim, Germany), 1987 , vol. 320, # 5 p. 430 - 437 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N'-(4-Chlor-phenyl)-N-formyl-N-methyl-harnstoff |
| Urea,3-(p-chlorophenyl)-1-formyl-1-methyl |
| 3-(4-Chlorphenyl)-1-formyl-1-methylharnstoff |
| Urea,N'-(4-chlorophenyl)-N-formyl-N-methyl |
| N'-(4-chloro-phenyl)-N-formyl-N-methyl-urea |
| 3-(4-chlorophenyl)-1-formyl-1-methylurea |