4-BENZYLOXY-3-BROMO-5-METHOXY-BENZALDEHYDE structure
|
Common Name | 4-BENZYLOXY-3-BROMO-5-METHOXY-BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 2556-04-9 | Molecular Weight | 321.16600 | |
| Density | 1.421g/cm3 | Boiling Point | 425.5ºC at 760mmHg | |
| Molecular Formula | C15H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 3-bromo-5-methoxy-4-phenylmethoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760mmHg |
| Molecular Formula | C15H13BrO3 |
| Molecular Weight | 321.16600 |
| Flash Point | 211.1ºC |
| Exact Mass | 320.00500 |
| PSA | 35.53000 |
| LogP | 3.84920 |
| Vapour Pressure | 1.9E-07mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | LHBCOPLQBMQCAF-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(Br)c1OCc1ccccc1 |
| HS Code | 2913000090 |
|---|
|
~96%
4-BENZYLOXY-3-B... CAS#:2556-04-9 |
| Literature: Vanucci-Bacque, Corinne; Chaabouni, Slim; Fabing, Isabelle; Bedos-Belval, Florence; Baltas, Michel Tetrahedron Letters, 2014 , vol. 55, # 2 p. 528 - 530 |
|
~%
4-BENZYLOXY-3-B... CAS#:2556-04-9 |
| Literature: Journal of the American Chemical Society, , vol. 71, p. 3851 |
|
~%
4-BENZYLOXY-3-B... CAS#:2556-04-9 |
| Literature: Organic letters, , vol. 3, # 17 p. 2661 - 2663 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-Methoxy-4-benzyloxy-5-brom-benzaldehyd |
| 5-Brom-vanillin-benzylaether |
| 4-(benzyloxy)-3-bromo-5-methoxybenzaldehyde |
| O-benzyl-3-bromovanillin |
| 4-Benzyloxy-3-brom-5-methoxy-benzaldehyd |
| 3-bromo-5-methoxy-4-(phenylmethoxy)benzaldehyde |