KUC-7322 structure
|
Common Name | KUC-7322 | ||
|---|---|---|---|---|
| CAS Number | 255734-04-4 | Molecular Weight | 373.44300 | |
| Density | 1.22g/cm3 | Boiling Point | 615.3ºC at 760mmHg | |
| Molecular Formula | C21H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.9ºC | |
Use of KUC-7322KUC-7322, a selective β3 -adrenoceptor agonist, is the active form of ritobegron. Ritobegron decreases intravesical pressure with minimal effects on the cardiovascular system. |
| Name | 2-[4-[2-[[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2,5-dimethylphenoxy]acetic acid |
|---|
| Description | KUC-7322, a selective β3 -adrenoceptor agonist, is the active form of ritobegron. Ritobegron decreases intravesical pressure with minimal effects on the cardiovascular system. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 615.3ºC at 760mmHg |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.44300 |
| Flash Point | 325.9ºC |
| Exact Mass | 373.18900 |
| PSA | 99.02000 |
| LogP | 3.11750 |
| Vapour Pressure | 5.36E-16mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | VMMYRRFPMAGXNP-BTYIYWSLSA-N |
| SMILES | Cc1cc(OCC(=O)O)c(C)cc1CCNC(C)C(O)c1ccc(O)cc1 |