5,6-diiodo-2-benzofuran-1,3-dione structure
|
Common Name | 5,6-diiodo-2-benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 25834-17-7 | Molecular Weight | 399.90900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H2I2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-diiodo-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H2I2O3 |
|---|---|
| Molecular Weight | 399.90900 |
| Exact Mass | 399.80900 |
| PSA | 43.37000 |
| LogP | 2.20640 |
| InChIKey | VPFSEDCCDPDXSV-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc(I)c(I)cc21 |
|
~%
5,6-diiodo-2-be... CAS#:25834-17-7 |
| Literature: Pratt; Perkins Journal of the American Chemical Society, 1918 , vol. 40, p. 230 |
|
~%
5,6-diiodo-2-be... CAS#:25834-17-7 |
| Literature: Pratt; Perkins Journal of the American Chemical Society, 1918 , vol. 40, p. 230 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4,5-Dijod-phthalsaeure-anhydrid |
| 4,5-diiodo-phthalic acid-anhydride |
| 1,3-Isobenzofurandione,5,6-diiodo |
| 4,5-diiodophthalic anhydride |