1-(4-aminophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one structure
|
Common Name | 1-(4-aminophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 25870-72-8 | Molecular Weight | 266.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-aminophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18N2O |
|---|---|
| Molecular Weight | 266.33800 |
| Exact Mass | 266.14200 |
| PSA | 46.33000 |
| LogP | 3.81210 |
| InChIKey | BJWWWAZDCHGYTO-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=CC(=O)c2ccc(N)cc2)cc1 |
|
~%
1-(4-aminopheny... CAS#:25870-72-8 |
| Literature: Srinivasa Rao Asian Journal of Chemistry, 2011 , vol. 23, # 10 p. 4373 - 4376 |
|
~%
1-(4-aminopheny... CAS#:25870-72-8 |
| Literature: Dzurilla,M.; Kristian,P. Collection of Czechoslovak Chemical Communications, 1970 , vol. 35, p. 417 - 429 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4-aminophenyl)-3-(4-dimethylaminophenyl)prop-2-en-1-one |
| 4-Dimethylamino-4'-aminochalcon |
| 4-dimethylamino-4'-amino-chalcone |
| 4-Dimethylamino-4'-aminochalkon |
| 2-Propen-1-one,1-(4-aminophenyl)-3-[4-(dimethylamino)phenyl] |