Calenduloside E structure
|
Common Name | Calenduloside E | ||
|---|---|---|---|---|
| CAS Number | 26020-14-4 | Molecular Weight | 632.824 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 750.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C36H56O9 | Melting Point | 243-245 ºC (decomp) | |
| MSDS | N/A | Flash Point | 228.6±26.4 °C | |
Use of Calenduloside ECalenduloside E (CE) is a natural pentacyclic triterpenoid saponin extracted from Aralia elata. Calenduloside E (CE) has anti-apoptotic potent by targeting heat shock protein 90 (Hsp90)[1]. |
| Name | Calenduloside E |
|---|---|
| Synonym | More Synonyms |
| Description | Calenduloside E (CE) is a natural pentacyclic triterpenoid saponin extracted from Aralia elata. Calenduloside E (CE) has anti-apoptotic potent by targeting heat shock protein 90 (Hsp90)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 750.8±60.0 °C at 760 mmHg |
| Melting Point | 243-245 ºC (decomp) |
| Molecular Formula | C36H56O9 |
| Molecular Weight | 632.824 |
| Flash Point | 228.6±26.4 °C |
| Exact Mass | 632.392456 |
| PSA | 153.75000 |
| LogP | 7.04 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | IUCHKMAZAWJNBJ-RCYXVVTDSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(O)C6O)C(C)(C)C5CCC43C)C2C1 |
| Water Solubility | Insuluble (2.2E-4 g/L) (25 ºC) |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Momordin Ib |
| Glycoside St-E |
| Polysciasaponin P7 |
| Silphioside F |
| Olean-12-en-28-oic acid, 3-(β-D-glucopyranuronosyloxy)-, (3β)- |
| (3β)-28-Hydroxy-28-oxoolean-12-en-3-yl β-D-glucopyranosiduronic acid |
| Oleanolic acid 3-O-glucuronide |
| Scheffleraside I |
| oleanolic acid 3-O-β-D-glucosiduronic acid |