diethyl (3-fluoro-4-nitrophenyl)methylmalonate structure
|
Common Name | diethyl (3-fluoro-4-nitrophenyl)methylmalonate | ||
|---|---|---|---|---|
| CAS Number | 78543-06-3 | Molecular Weight | 313.27800 | |
| Density | 1.28g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C14H16FNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | diethyl 2-[(3-fluoro-4-nitrophenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C14H16FNO6 |
| Molecular Weight | 313.27800 |
| Flash Point | 202.4ºC |
| Exact Mass | 313.09600 |
| PSA | 98.42000 |
| LogP | 2.54200 |
| Index of Refraction | 1.513 |
| InChIKey | VHMVOAWAZZEEPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)c1ccc([N+](=O)[O-])c(F)c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2917399090 |
|
~86%
diethyl (3-fluo... CAS#:78543-06-3 |
| Literature: Peretto, Ilaria; Radaelli, Stefano; Parini, Carlo; Zandi, Michele; Raveglia, Luca F.; Dondio, Giulio; Fontanella, Laura; Misiano, Paola; Bigogno, Chiara; Rizzi, Andrea; Riccardi, Benedetta; Biscaioli, Marcello; Marchetti, Silvia; Puccini, Paola; Catinella, Silvia; Rondelli, Ivano; Cenacchi, Valentina; Bolzoni, Pier Tonino; Caruso, Paola; Villetti, Gino; Facchinetti, Fabrizio; Del Giudice, Elda; Moretto, Nadia; Imbimbo, Bruno P. Journal of Medicinal Chemistry, 2005 , vol. 48, # 18 p. 5705 - 5720 |
|
~%
diethyl (3-fluo... CAS#:78543-06-3 |
| Literature: The Upjohn Company Patent: US4266069 A1, 1981 ; |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD03617764 |