4-nitrophenylsulfur pentafluoride structure
|
Common Name | 4-nitrophenylsulfur pentafluoride | ||
|---|---|---|---|---|
| CAS Number | 2613-27-6 | Molecular Weight | 249.15800 | |
| Density | N/A | Boiling Point | 76-77°C 12mm | |
| Molecular Formula | C6H4F5NO2S | Melting Point | 38 °C | |
| MSDS | N/A | Flash Point | 76-77°C/12mm | |
| Name | pentafluoro-(4-nitrophenyl)-λ6-sulfane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 76-77°C 12mm |
|---|---|
| Melting Point | 38 °C |
| Molecular Formula | C6H4F5NO2S |
| Molecular Weight | 249.15800 |
| Flash Point | 76-77°C/12mm |
| Exact Mass | 248.98800 |
| PSA | 71.12000 |
| LogP | 4.77540 |
| Index of Refraction | 1.4729 |
| InChIKey | AGNCKMHGYZKMLN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(F)(F)(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant;T: Toxic; |
|---|---|
| Risk Phrases | R23/24/25;R36/38 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3261 |
| Packaging Group | III |
| Hazard Class | 6.1 |
|
~59%
4-nitrophenylsu... CAS#:2613-27-6 |
| Literature: British Nuclear Fuels plc Patent: US6747178 B1, 2004 ; Location in patent: Page column 6 ; |
|
~61%
4-nitrophenylsu... CAS#:2613-27-6 |
| Literature: AIR PRODUCTS AND CHEMICALS, INC. Patent: EP1484318 A1, 2004 ; Location in patent: Page 10; 11 ; |
|
~%
4-nitrophenylsu... CAS#:2613-27-6 |
| Literature: Umemoto, Teruo; Garrick, Lloyd M.; Saito, Norimichi Beilstein Journal of Organic Chemistry, 2012 , vol. 8, p. 461 - 471 |
|
~%
4-nitrophenylsu... CAS#:2613-27-6 |
| Literature: AIR PRODUCTS AND CHEMICALS, INC. Patent: EP1484318 A1, 2004 ; Location in patent: Page 12 ; |
|
~27%
4-nitrophenylsu... CAS#:2613-27-6 |
| Literature: British Nuclear Fuels plc Patent: US5741935 A1, 1998 ; |
| pentafluoro-(4-nitrophenyl) |
| 4-(Pentafluorothio)nitrobenzene |
| 1-nitro-4-(pentafluorosulfanyl)benzene |
| 4-Nitropentafluorosulfuranylbenzene |
| 4-nitro(pentafluorosulfanyl)benzene |
| p-nitro(pentafluorosulfanyl)benzene |
| para-nitro(pentafluorosulfanyl)benzenes |
| MFCD00221619 |
| para-nitro-(pentafluorosulfanyl)benzene |
| p-nitro-(pentafluorosufanyl)benzene |
| EINECS 447-610-7 |
| 4-Nitrophenylsulfur pentafluoride |
| 4-nitrophenylsulphur pentafluoride |