Benzenesulfonamide,N,N-bis(2-cyanoethyl)-4-methyl- structure
|
Common Name | Benzenesulfonamide,N,N-bis(2-cyanoethyl)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 2619-16-1 | Molecular Weight | 277.34200 | |
| Density | 1.237g/cm3 | Boiling Point | 508.9ºC at 760mmHg | |
| Molecular Formula | C13H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.6ºC | |
| Name | 3,3'-iminodipropanoic acid tosylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 508.9ºC at 760mmHg |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.34200 |
| Flash Point | 261.6ºC |
| Exact Mass | 277.08800 |
| PSA | 93.34000 |
| LogP | 2.89386 |
| Vapour Pressure | 1.78E-10mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | QQEHNFXDLPBZSJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(CCC#N)CCC#N)cc1 |
| HS Code | 2935009090 |
|---|
|
~74%
Benzenesulfonam... CAS#:2619-16-1 |
| Literature: Gimbert, Carolina; Moreno-Manas, Marcial; Perez, Elisabet; Vallribera, Adelina Tetrahedron, 2007 , vol. 63, # 34 p. 8305 - 8310 |
|
~89%
Benzenesulfonam... CAS#:2619-16-1 |
| Literature: Pratt, John A. E.; Sutherland, Ian O.; Newton, Roger F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 13 - 22 |
|
~%
Benzenesulfonam... CAS#:2619-16-1 |
| Literature: Novacek,A. Collection of Czechoslovak Chemical Communications, 1967 , vol. 32, # 10 p. 3565 - 3571 |
|
~%
Benzenesulfonam... CAS#:2619-16-1 |
| Literature: Kretow; Romasanowitsch Zhurnal Obshchei Khimii, 1958 , vol. 28, p. 1059,1061;engl.Ausg.S.1029 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-p-Tosyl-bis(2-cyanethyl)amin |
| N-tosyl-3,3'-iminobispropionic acid |
| N-P-TOLUENESULPHONYLIMINO-3,3'-DIPROPIONIC ACID |
| N,N-Bis-(2-cyan-aethyl)-toluol-4-sulfonamid |
| 3,3'-(toluene-4-sulfonylimino)-di-propionic acid |
| 3,3'-(Toluol-4-sulfonylimino)-di-propionsaeure |
| N-tosyl-3,3'-iminobispropionitrile |
| N,N-bis-(2-cyano-ethyl)-toluene-4-sulfonamide |
| N,N-bis[(2-cyanoethyl)]-4-methylbenzenesulfonamide |
| p-Toluolsulfonsaeure-<bis-(2-cyan-ethyl)-amid> |
| p-Toluolsulfonsaeure-<bis-(2-carboxy-ethyl)-amid> |
| N,N-Bis-<2-carboxy-aethyl>-p-toluolsulfonsaeure-amid |