b-Alanine,N-[(4-methylphenyl)sulfonyl]- structure
|
Common Name | b-Alanine,N-[(4-methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 42908-33-8 | Molecular Weight | 243.28000 | |
| Density | N/A | Boiling Point | 442.3ºC at 760 mmHg | |
| Molecular Formula | C10H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.3ºC | |
| Name | 3-[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 442.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28000 |
| Flash Point | 221.3ºC |
| Exact Mass | 243.05700 |
| PSA | 91.85000 |
| LogP | 2.21970 |
| InChIKey | PPDKUGSOVUQARL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)O)cc1 |
| HS Code | 2922499990 |
|---|
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-(Toluene-4-sulfonylamino)-propionic acid |
| 3-{[(4-methylphenyl)sulfonyl]amino}propanoic acid |
| |A-alanine,n-[(4-methylphenyl)sulfonyl] |
| 3-(4-methylbenzenesulfonamido)propanoic acid |