Anti-MRSA agent 1 structure
|
Common Name | Anti-MRSA agent 1 | ||
|---|---|---|---|---|
| CAS Number | 2627336-02-9 | Molecular Weight | 535.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29N7O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Anti-MRSA agent 1Anti-MRSA agent 1 (Compound 13d) is a wonderful MRSA (MIC = 0.5 μg/mL) inhibitor. Anti-MRSA agent 1 (Compound 13d) could effectually relieve the development of MRSA resistance[1]. |
| Name | Anti-MRSA agent 1 |
|---|
| Description | Anti-MRSA agent 1 (Compound 13d) is a wonderful MRSA (MIC = 0.5 μg/mL) inhibitor. Anti-MRSA agent 1 (Compound 13d) could effectually relieve the development of MRSA resistance[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H29N7O4S |
|---|---|
| Molecular Weight | 535.62 |
| InChIKey | NURGQGCOEFLLOU-QUPMIFSKSA-N |
| SMILES | CON=C(C(=O)N1CCN(c2ccc3c4c(cccc24)C(=O)N(CCN(C)C)C3=O)CC1)c1csc(N)n1 |