3-butene-1,2,3-tricarboxylic acid structure
|
Common Name | 3-butene-1,2,3-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 26326-05-6 | Molecular Weight | 188.13500 | |
| Density | 1.526 g/cm3 | Boiling Point | 436.3ºC at 760 mmHg | |
| Molecular Formula | C7H8O6 | Melting Point | 177 °C | |
| MSDS | N/A | Flash Point | 231.8ºC | |
| Name | but-3-ene-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526 g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760 mmHg |
| Melting Point | 177 °C |
| Molecular Formula | C7H8O6 |
| Molecular Weight | 188.13500 |
| Flash Point | 231.8ºC |
| Exact Mass | 188.03200 |
| PSA | 111.90000 |
| Vapour Pressure | 7.8E-09mmHg at 25°C |
| InChIKey | WOZHZOLFFPSEAM-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)O)C(CC(=O)O)C(=O)O |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2917190090 |
|
~%
3-butene-1,2,3-... CAS#:26326-05-6 |
| Literature: Morita,K.-I.; Kobayashi,T. Bulletin of the Chemical Society of Japan, 1969 , vol. 42, p. 2732 |
|
~%
3-butene-1,2,3-... CAS#:26326-05-6 |
| Literature: The Lubrizol Corporation Patent: US4151173 A1, 1979 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-BUTENE-1,2,3-TRICARBOXYLIC ACID |
| HMS1668M07 |
| EINECS 247-612-6 |
| 1-butene-2,3,4-tricarboxylic acid ester |
| MFCD00014344 |