1H-Pyrrole-2,5-dione,1-(2,4-dichlorophenyl)- structure
|
Common Name | 1H-Pyrrole-2,5-dione,1-(2,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 26396-57-6 | Molecular Weight | 242.05800 | |
| Density | 1.57g/cm3 | Boiling Point | 376.6ºC at 760mmHg | |
| Molecular Formula | C10H5Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.5ºC | |
| Name | 1-(2,4-dichloro-phenyl)-pyrrole-2,5-dione |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 376.6ºC at 760mmHg |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.05800 |
| Flash Point | 181.5ºC |
| Exact Mass | 240.97000 |
| PSA | 37.38000 |
| LogP | 2.48780 |
| Vapour Pressure | 7.18E-06mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | BZUKGARCPDEBLG-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(Cl)cc1Cl |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |