1H-PYRROLE-2,5-DIONE, 1-(2,4-DIMETHOXYPHENYL)- structure
|
Common Name | 1H-PYRROLE-2,5-DIONE, 1-(2,4-DIMETHOXYPHENYL)- | ||
|---|---|---|---|---|
| CAS Number | 67154-42-1 | Molecular Weight | 233.22000 | |
| Density | 1.308g/cm3 | Boiling Point | 404.2ºC at 760 mmHg | |
| Molecular Formula | C12H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | 1-(2,4-dimethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 404.2ºC at 760 mmHg |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22000 |
| Flash Point | 198.2ºC |
| Exact Mass | 233.06900 |
| PSA | 55.84000 |
| LogP | 1.19820 |
| Index of Refraction | 1.584 |
| InChIKey | FZOPHURHMRGGIY-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)C=CC2=O)c(OC)c1 |
|
~%
1H-PYRROLE-2,5-... CAS#:67154-42-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 9 p. 2823 - 2834 |
|
~%
1H-PYRROLE-2,5-... CAS#:67154-42-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 9 p. 2823 - 2834 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| F1383-0003 |
| N-(2,4-dimethoxyphenyl)maleimide |
| 1-(2,4-dimethoxy-phenyl)-pyrrole-2,5-dione |
| 1-(2,4-dimethoxyphenyl)-1H-pyrrole-2,5-dione |
| 1-(2,4-dimethoxyphenyl)azoline-2,5-dione |