Thalidomide-NH-PEG7 structure
|
Common Name | Thalidomide-NH-PEG7 | ||
|---|---|---|---|---|
| CAS Number | 2641838-98-2 | Molecular Weight | 581.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H39N3O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-NH-PEG7Thalidomide-NH-PEG7 is a synthesized E3 ligase ligand-linker conjugate for ADC. Thalidomide-NH-PEG7 can be connected to the ligand for protein by a linker to form PROTAC iRucaparib-AP6, a highly specific PARP1 degrader[1]. |
| Name | Thalidomide-NH-PEG7 |
|---|
| Description | Thalidomide-NH-PEG7 is a synthesized E3 ligase ligand-linker conjugate for ADC. Thalidomide-NH-PEG7 can be connected to the ligand for protein by a linker to form PROTAC iRucaparib-AP6, a highly specific PARP1 degrader[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| References |
| Molecular Formula | C27H39N3O11 |
|---|---|
| Molecular Weight | 581.61 |
| InChIKey | FDUDLKYDKJZCFR-UHFFFAOYSA-N |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOCCOCCOCCOCCO)c3C2=O)C(=O)N1 |
| Hazard Codes | Xi |
|---|