1-chloro-4-[1-(4-chlorophenyl)ethyl]benzene structure
|
Common Name | 1-chloro-4-[1-(4-chlorophenyl)ethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 3547-04-4 | Molecular Weight | 251.15100 | |
| Density | 1.195g/cm3 | Boiling Point | 332.5ºC at 760mmHg | |
| Molecular Formula | C14H12Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.6ºC | |
| Name | 1-chloro-4-[1-(4-chlorophenyl)ethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760mmHg |
| Molecular Formula | C14H12Cl2 |
| Molecular Weight | 251.15100 |
| Flash Point | 143.6ºC |
| Exact Mass | 250.03200 |
| LogP | 5.14520 |
| Index of Refraction | 1.581 |
| InChIKey | KTEARTXATWOYDB-UHFFFAOYSA-N |
| SMILES | CC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2903999090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p,p'-Dichlorodiphenyl ethane |
| DDNS |
| Dimic |
| K 3926 |