Ethanone,1,2-bis(4-chlorophenyl)-2-hydroxy- structure
|
Common Name | Ethanone,1,2-bis(4-chlorophenyl)-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 4254-20-0 | Molecular Weight | 281.13400 | |
| Density | 1.379g/cm3 | Boiling Point | 439.1ºC at 760mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4ºC | |
| Name | 1,2-bis(4-chlorophenyl)-2-hydroxyethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 439.1ºC at 760mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 219.4ºC |
| Exact Mass | 280.00600 |
| PSA | 37.30000 |
| LogP | 3.90970 |
| Index of Refraction | 1.625 |
| InChIKey | UCXPESOPEKJXJR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Benzoin,4,4'-dichloro |
| 4,4'-dichlorobenzoin |
| 4,4'-dichlorodeoxybenzoin |
| Benzoin,4'-dichloro |
| Ethanone,2-bis(4-chlorophenyl)-2-hydroxy |
| 1,2-bis(4-chlorophenyl)-2-hydroxy-ethanone |
| 1,2-bis(p-chlorophenyl)-2-hydroxyethanone |
| 1,2-bis(4-chlorophenyl)-2-hydroxyethan-1-one |