oil blue n structure
|
Common Name | oil blue n | ||
|---|---|---|---|---|
| CAS Number | 2646-15-3 | Molecular Weight | 378.50700 | |
| Density | 1.146g/cm3 | Boiling Point | 586ºC at 760mmHg | |
| Molecular Formula | C24H30N2O2 | Melting Point | 210ºC | |
| MSDS | Chinese USA | Flash Point | 179.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4-bis(pentylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 586ºC at 760mmHg |
| Melting Point | 210ºC |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.50700 |
| Flash Point | 179.9ºC |
| Exact Mass | 378.23100 |
| PSA | 58.20000 |
| LogP | 5.81220 |
| Vapour Pressure | 1.03E-13mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | RHGBRYSELHPAFL-UHFFFAOYSA-N |
| SMILES | CCCCCNc1ccc(NCCCCC)c2c1C(=O)c1ccccc1C2=O |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
|
~64%
oil blue n CAS#:2646-15-3 |
| Literature: Lehmler; Telu; Vyas; Shaikh; Rankin; Knutson; Parkin Tetrahedron, 2010 , vol. 66, # 14 p. 2561 - 2569 |
| Solvent Blue 14 |
| Oil blue N |
| Ext. D and C Blue No. 5 |
| oil blue m |
| Amino-quinone |
| MFCD00001200 |
| C.I. Solvent Blue 14 |