KRAS G12C inhibitor 33 structure
|
Common Name | KRAS G12C inhibitor 33 | ||
|---|---|---|---|---|
| CAS Number | 2648985-02-6 | Molecular Weight | 539.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H33N7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KRAS G12C inhibitor 33KRAS G12C inhibitor 33 is a KRAS G12C inhibitor extracted from patent WO2021244603A1, compound 1. KRAS G12C inhibitor 33 can be used for the research of cancer[1]. |
| Name | KRAS G12C inhibitor 33 |
|---|
| Description | KRAS G12C inhibitor 33 is a KRAS G12C inhibitor extracted from patent WO2021244603A1, compound 1. KRAS G12C inhibitor 33 can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
KRAS G12C[1] |
| References |
[1]. Shan B, et, al. Inhibitors of kras g12c protein and uses thereof. WO2021244603A1. |
| Molecular Formula | C30H33N7O3 |
|---|---|
| Molecular Weight | 539.63 |
| InChIKey | BZZYACFDPKVXKG-QFIPXVFZSA-N |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC3CCCN3C)nc3c(=O)n(-c4cccc5ccccc45)c(C)nc23)CC1 |