Urea,N-butyl-N'-(3-chloro-4-methylphenyl)- structure
|
Common Name | Urea,N-butyl-N'-(3-chloro-4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 26683-56-7 | Molecular Weight | 240.72900 | |
| Density | 1.151g/cm3 | Boiling Point | 328.2ºC at 760 mmHg | |
| Molecular Formula | C12H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.3ºC | |
| Name | 1-butyl-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 328.2ºC at 760 mmHg |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.72900 |
| Flash Point | 152.3ºC |
| Exact Mass | 240.10300 |
| PSA | 41.13000 |
| LogP | 4.03390 |
| Vapour Pressure | 0.000193mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | MQLLCOMAMCZGLC-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)Nc1ccc(C)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-butyl-1-(3-chloro-4-methylphenyl)urea |