2,6-Dioxo-5-ethyl-5-phenyl-3-piperidyl thiocyanate structure
|
Common Name | 2,6-Dioxo-5-ethyl-5-phenyl-3-piperidyl thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 26723-07-9 | Molecular Weight | 274.33800 | |
| Density | 1.28g/cm3 | Boiling Point | 503.7ºC at 760mmHg | |
| Molecular Formula | C14H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | (5-ethyl-2,6-dioxo-5-phenylpiperidin-3-yl) thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 503.7ºC at 760mmHg |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.33800 |
| Flash Point | 258.4ºC |
| Exact Mass | 274.07800 |
| PSA | 98.75000 |
| LogP | 2.23968 |
| Vapour Pressure | 2.85E-10mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | CVFPKDGHOZFUDV-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)CC(SC#N)C(=O)NC1=O |
| HS Code | 2930909090 |
|---|
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Fenil-2-etil-4-tiociano-glutarimmide [Italian] |
| 5-ethyl-2,6-dioxo-5-phenylpiperidin-3-yl thiocyanate |
| 2,6-Piperidinedione,3-ethyl-3-phenyl-5-thiocyanato |
| 2-Fenyl-2-ethyl-4-thiocyano-glutarimid |
| 4-Thiocyanato-2-ethyl-2-phenyl-glutarimid |
| Thiocyanic acid,2,6-dioxo-5-ethyl-5-phenyl-3-piperidinyl ester |
| 3-ethyl-3-phenyl-5-thiocyanato-piperidine-2,6-dione |
| 2,6-Dioxo-5-ethyl-5-phenyl-3-piperidyl ester of thiocyanic acid |