H-Asp(OBut)-OmeHCL structure
|
Common Name | H-Asp(OBut)-OmeHCL | ||
|---|---|---|---|---|
| CAS Number | 2673-19-0 | Molecular Weight | 239.697 | |
| Density | N/A | Boiling Point | 301.1ºC at 760mmHg | |
| Molecular Formula | C9H18ClNO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 135.9ºC | |
Use of H-Asp(OBut)-OmeHCLH-Asp(OtBu)-OMe.HCl is an aspartic acid derivative[1]. |
| Name | 4-O-tert-butyl 1-O-methyl (2S)-2-aminobutanedioate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | H-Asp(OtBu)-OMe.HCl is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 301.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C9H18ClNO4 |
| Molecular Weight | 239.697 |
| Flash Point | 135.9ºC |
| Exact Mass | 239.092438 |
| PSA | 78.62000 |
| LogP | 1.72080 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.000807mmHg at 25°C |
| InChIKey | SFYKWYAIJZEDNG-RGMNGODLSA-N |
| SMILES | COC(=O)C(N)CC(=O)OC(C)(C)C.Cl |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922499990 |
|
~%
H-Asp(OBut)-OmeHCL CAS#:2673-19-0 |
| Literature: LG Chem Investment Ltd. Patent: US6747050 B1, 2004 ; Location in patent: Page/Page column 45 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| H-Asp(OtBu)-OMe |
| H-Asp(OtBu)-OMe inverted exclamation mark currencyHCl |
| H-Asp(OtBu)-OMe,HCl |
| H-Asp(OtBu)-OMe hydrochloride |
| H-Asp(OtBu)-OMe HCl |
| L-Aspartic acid 4-tert-butyl-1-methyl ester hydrochloride |
| 1-Methyl 4-(2-methyl-2-propanyl) L-aspartate hydrochloride (1:1) |
| L-Aspartic acid, 4-(1,1-dimethylethyl) 1-methyl ester, hydrochloride (1:1) |
| H-Asp(OtBu)-OMe.HCl |
| H-Asp(OBut)-OmeHCL |