2-[(carboxymethyl)thio]-4,5-dimethoxybenzoic acid structure
|
Common Name | 2-[(carboxymethyl)thio]-4,5-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 26791-94-6 | Molecular Weight | 272.27400 | |
| Density | 1.45g/cm3 | Boiling Point | 456.6ºC at 760mmHg | |
| Molecular Formula | C11H12O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9ºC | |
| Name | 2-(carboxymethylsulfanyl)-4,5-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 456.6ºC at 760mmHg |
| Molecular Formula | C11H12O6S |
| Molecular Weight | 272.27400 |
| Flash Point | 229.9ºC |
| Exact Mass | 272.03500 |
| PSA | 118.36000 |
| LogP | 1.57870 |
| Vapour Pressure | 3.95E-09mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | PYMSTJLTQHAJIG-UHFFFAOYSA-N |
| SMILES | COc1cc(SCC(=O)O)c(C(=O)O)cc1OC |
|
~%
2-[(carboxymeth... CAS#:26791-94-6 |
| Literature: Bew; Clemo Journal of the Chemical Society, 1953 , p. 1314 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| EINECS 248-009-0 |
| 2-carboxymethylsulfanyl-4,5-dimethoxy-benzoic acid |
| 2-Carboxymethylmercapto-4,5-dimethoxy-benzoesaeure |
| Veratricacid,6-[(carboxymethyl)thio]-(8CI) |
| 2-[(carboxymethyl)thio]-4,5-dimethoxybenzoic acid |