Methyl 3-oxo-4-androstene-17β-carboxylate structure
|
Common Name | Methyl 3-oxo-4-androstene-17β-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2681-55-2 | Molecular Weight | 330.461 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.5±28.8 °C | |
| Name | Methyl 3-oxo-4-androstene-17beta-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.8±45.0 °C at 760 mmHg |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.461 |
| Flash Point | 191.5±28.8 °C |
| Exact Mass | 330.219482 |
| PSA | 43.37000 |
| LogP | 4.37 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | XWFWMYFLNHTEBF-YFWFAHHUSA-N |
| SMILES | COC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |
| HS Code | 2937290090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2937290090 |
|---|
|
Name: Ratio of IC50 to that of 10x compound against Steroid 5-alpha-reductase
Source: ChEMBL
Target: 3-oxo-5-alpha-steroid 4-dehydrogenase 2
External Id: CHEMBL814228
|
|
Name: Inhibition of Steroid 5-alpha-reductase from rat prostate
Source: ChEMBL
Target: 3-oxo-5-alpha-steroid 4-dehydrogenase 1
External Id: CHEMBL813359
|
|
Name: In vitro antagonist activity against rat prostatic androgen receptor (AR)
Source: ChEMBL
Target: Androgen receptor
External Id: CHEMBL652259
|
| (8S,9S,10R,13S,14S,17S)-3-keto-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylic acid methyl ester |
| methyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate |
| METHYL 4-ANDROSTEN-3-ONE-17BETA-CARBOXYLINATE |
| (8S,9S,10R,13S,14S,17S)-methyl 10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| Methyl-3-oxo-4-androstene-17beta-carboxylate |
| Methyl (17β)-3-oxoandrost-4-ene-17-carboxylate |
| Methyl 3-oxo-4-androstene-17β-carboxylate |