N,N'-ditert-butylethanedithioamide structure
|
Common Name | N,N'-ditert-butylethanedithioamide | ||
|---|---|---|---|---|
| CAS Number | 26818-54-2 | Molecular Weight | 232.40900 | |
| Density | 1.05g/cm3 | Boiling Point | 285.9ºC at 760 mmHg | |
| Molecular Formula | C10H20N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.7ºC | |
| Name | N,N'-ditert-butylethanedithioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 285.9ºC at 760 mmHg |
| Molecular Formula | C10H20N2S2 |
| Molecular Weight | 232.40900 |
| Flash Point | 126.7ºC |
| Exact Mass | 232.10700 |
| PSA | 88.24000 |
| LogP | 3.19920 |
| Vapour Pressure | 0.00272mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | NGWBYIDKLSDROL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=S)C(=S)NC(C)(C)C |
|
~%
N,N'-ditert-but... CAS#:26818-54-2 |
| Literature: Halder, T.; Schwarz, W.; Weidlein, J.; Fischer, P. Journal of Organometallic Chemistry, 1983 , vol. 246, # 1 p. 29 - 48 |
|
~86%
N,N'-ditert-but... CAS#:26818-54-2 |
| Literature: Bock, Hans; Haenel, Peter; Herrmann, H.-F.; Dieck, Heindirk tom Zeitschrift fuer Naturforschung, B: Chemical Sciences, 1988 , vol. 43, # 10 p. 1240 - 1246 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-Bis(tert-butyl)dithioxamid |
| N,N'-Di-tert-butyldithio oxamide |
| OXAMIDE,N,N'-DI-tert-BUTYLDITHIO |
| USAF PD-74 |
| N,N'-Di-tert-butyldithioxamid |