4-(4-Nitrophenyl)piperidine structure
|
Common Name | 4-(4-Nitrophenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 26905-03-3 | Molecular Weight | 206.241 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 347.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.7±27.9 °C | |
| Name | 4-(4-nitrophenyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.0±42.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.241 |
| Flash Point | 163.7±27.9 °C |
| Exact Mass | 206.105530 |
| PSA | 57.85000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | CDSJZBOLNDWPAA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2CCNCC2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| nitrophenylpiperidine |
| 4-(4-Nitro-phenyl)-piperidin |
| 4-(4-Nitrophenyl)piperidine |
| Piperidine,4-(4-nitrophenyl) |
| 4-(4-Nitro-phenyl)-piperidine |