Boc-(R)-3-amino-4-(3,4-dichloro-phenyl)-butyric acid structure
|
Common Name | Boc-(R)-3-amino-4-(3,4-dichloro-phenyl)-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 269396-56-7 | Molecular Weight | 348.222 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 484.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H19Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7±28.7 °C | |
| Name | Boc-(R)-3-amino-4-(3,4-dichlorophenyl)butyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 484.4±45.0 °C at 760 mmHg |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.222 |
| Flash Point | 246.7±28.7 °C |
| Exact Mass | 347.069122 |
| PSA | 75.63000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | WJEUUKADFJNOHW-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(Cl)c(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01860949 |
| Benzenebutanoic acid, 3,4-dichloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)- |
| Pentanedioic acid, 3-amino-2-(3,4-dichlorophenyl)-, 1-(1,1-dimethylethyl) ester, (3R)- |
| (3R)-4-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| (R)-3-(Boc-amino)-4-(3,4-dichlorophenyl)butyric acid |
| (3R)-3-Amino-4-(3,4-dichlorophenyl)-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| (3R)-4-(3,4-Dichlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |