Antiviral agent 5 structure
|
Common Name | Antiviral agent 5 | ||
|---|---|---|---|---|
| CAS Number | 2698336-82-0 | Molecular Weight | 386.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Antiviral agent 5Antiviral agent 5 is an intermediate used in antiviral agents targeting 3C and 3CL proteases including SARS-CoV-2 Mpro. |
| Name | Antiviral agent 5 |
|---|
| Description | Antiviral agent 5 is an intermediate used in antiviral agents targeting 3C and 3CL proteases including SARS-CoV-2 Mpro. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H30N2O7 |
|---|---|
| Molecular Weight | 386.44 |
| InChIKey | HRSYZHWLVOLMAM-RYUDHWBXSA-N |
| SMILES | COC(=O)C(CC1CCNC1=O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |