2-phenylindole-3-acetonitrile structure
|
Common Name | 2-phenylindole-3-acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 27005-52-3 | Molecular Weight | 232.28000 | |
| Density | 1.201g/cm3 | Boiling Point | 120 °C (20.2527 mmHg) | |
| Molecular Formula | C16H12N2 | Melting Point | 217-224 °C | |
| MSDS | N/A | Flash Point | 154.4ºC | |
| Name | 2-(2-phenyl-1H-indol-3-yl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 120 °C (20.2527 mmHg) |
| Melting Point | 217-224 °C |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28000 |
| Flash Point | 154.4ºC |
| Exact Mass | 232.10000 |
| PSA | 39.58000 |
| LogP | 3.90098 |
| Vapour Pressure | 6.75E-10mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | CNAHOBNLHXZPRN-UHFFFAOYSA-N |
| SMILES | N#CCc1c(-c2ccccc2)[nH]c2ccccc12 |
| Water Solubility | 100 g/100 mL |
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
|---|---|
| Safety Phrases | S36/37/39 |
| RIDADR | 3276 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-3-indolylacetonitrile |
| 2-Phenylindol-3-yl-acetonitril |
| 2-Phenylindole-3-acetonitrile |
| 1H-Indole-3-acetonitrile,2-phenyl |
| MFCD00798596 |