2,2'-[Sulfonylbis(4,1-phenyleneoxy)]diethanol structure
|
Common Name | 2,2'-[Sulfonylbis(4,1-phenyleneoxy)]diethanol | ||
|---|---|---|---|---|
| CAS Number | 27205-03-4 | Molecular Weight | 338.375 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 582.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O6S | Melting Point | 179-183ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 306.1±28.7 °C | |
| Name | 2-[4-[4-(2-hydroxyethoxy)phenyl]sulfonylphenoxy]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.5±45.0 °C at 760 mmHg |
| Melting Point | 179-183ºC(lit.) |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.375 |
| Flash Point | 306.1±28.7 °C |
| Exact Mass | 338.082397 |
| PSA | 101.44000 |
| LogP | 0.88 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | UTNSTOOXQPHXJQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(OCCO)cc1)c1ccc(OCCO)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909499000 |
|
~%
2,2'-[Sulfonylb... CAS#:27205-03-4 |
| Literature: Lotti; Colonna; Fiorini; Finelli; Berti Polymer, 2011 , vol. 52, # 4 p. 904 - 911 |
|
~%
2,2'-[Sulfonylb... CAS#:27205-03-4 |
| Literature: Eastman Kodak Co. Patent: US2593411 , 1949 ; |
|
~%
2,2'-[Sulfonylb... CAS#:27205-03-4 |
| Literature: Union Carbide and Carbon Corp. Patent: US2573769 , 1949 ; |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Screening of bisphenol A, triclosan and paraben analogues as modulators of the glucocorticoid and androgen receptor activities.
Toxicol. In Vitro 29(1) , 8-15, (2014) A homeostasis of the glucocorticoid and androgen endocrine system is essential to human health. Their disturbance can lead to various diseases, for example cardiovascular, inflammatory and autoimmune ... |
| 4-(2-Hydroxyethoxy)phenyl Sulfone |
| Ethanol, 2,2'-[sulfonylbis(4,1-phenyleneoxy)]bis- |
| 2,2'-(Sulphonylbis(4,1-phenyleneoxy))bisethanol |
| 2,2'-[Sulfonylbis(4,1-phenyleneoxy)]diethanol |
| EINECS 248-320-1 |
| Bis[4-(2-hydroxyethoxy)phenyl] Sulfone |
| MFCD00130282 |