Acetic acid,2,2'-[sulfonylbis(4,1-phenyleneoxy)]bis- (9CI) structure
|
Common Name | Acetic acid,2,2'-[sulfonylbis(4,1-phenyleneoxy)]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 30596-06-6 | Molecular Weight | 366.34300 | |
| Density | 1.476g/cm3 | Boiling Point | 639.2ºC at 760 mmHg | |
| Molecular Formula | C16H14O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.4ºC | |
| Name | 2-[4-[4-(carboxymethoxy)phenyl]sulfonylphenoxy]acetic acid |
|---|
| Density | 1.476g/cm3 |
|---|---|
| Boiling Point | 639.2ºC at 760 mmHg |
| Molecular Formula | C16H14O8S |
| Molecular Weight | 366.34300 |
| Flash Point | 340.4ºC |
| Exact Mass | 366.04100 |
| PSA | 135.58000 |
| LogP | 2.52700 |
| Index of Refraction | 1.606 |
| InChIKey | MWTGMPRNUBZHCH-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)c2ccc(OCC(=O)O)cc2)cc1 |
|
~73%
Acetic acid,2,2... CAS#:30596-06-6 |
| Literature: Vansdadia; Roda; Parekh Journal of the Indian Chemical Society, 1988 , vol. 65, # 10 p. 733 - 735 |
|
~%
Acetic acid,2,2... CAS#:30596-06-6 |
| Literature: Garchar; Parsania Journal of the Indian Chemical Society, 1996 , vol. 73, # 7 p. 359 - 361 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |