3-Pyrazolin-5-one, 1,2-diphenyl-3-methoxy- structure
|
Common Name | 3-Pyrazolin-5-one, 1,2-diphenyl-3-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 37585-38-9 | Molecular Weight | 266.29500 | |
| Density | 1.28g/cm3 | Boiling Point | 403.1ºC at 760mmHg | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | 5-methoxy-1,2-diphenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760mmHg |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29500 |
| Flash Point | 197.6ºC |
| Exact Mass | 266.10600 |
| PSA | 36.16000 |
| LogP | 2.63680 |
| Index of Refraction | 1.67 |
| InChIKey | ATUOIKVQJQROMF-UHFFFAOYSA-N |
| SMILES | COc1cc(=O)n(-c2ccccc2)n1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
|
~%
3-Pyrazolin-5-o... CAS#:37585-38-9 |
| Literature: Capuano Chemische Berichte, 1959 , vol. 92, p. 2670,2673 |
|
~%
3-Pyrazolin-5-o... CAS#:37585-38-9 |
| Literature: Capuano Chemische Berichte, 1959 , vol. 92, p. 2670,2673 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Diphenyl-3-methoxy-3-pyrazolin-5-one |
| 3-Methoxy-1,2-diphenyl-5-pyrazolone |
| 5-methoxy-1,2-diphenyl-1,2-dihydro-3h-pyrazol-3-one |
| 1,2-Dihydro-5-methoxy-1,2-diphenyl-3H-pyrazol-3-one |
| 5-methoxy-1,2-diphenyl-1,2-dihydro-pyrazol-3-one |
| 1,2-Diphenyl-3-methoxy-5-pyrazolon |
| 3-Pyrazolin-5-one,1,2-diphenyl-3-methoxy |