Pomalidomide-C5-Dovitinib structure
|
Common Name | Pomalidomide-C5-Dovitinib | ||
|---|---|---|---|---|
| CAS Number | 2732969-67-2 | Molecular Weight | 747.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H38FN9O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide-C5-DovitinibPomalidomide-C5-Dovitinib (compound 2) is a PROTAC containing Pomalidomide, Dovitinib and connected with CRBN. Pomalidomide-C5-Dovitinib shows enhanced antiproliferative effects against FLT3-ITD+ AML cells. Pomalidomide-C5-Dovitinib induces the degradation of the FLT3-ITD and KIT proteins in a ubiquitin-proteasome-dependent manner and completely blocks their downstream signaling pathway. Pomalidomide-C5-Dovitinib has the potential for the research of FLT3-ITD+ acute myeloid leukemia[1]. |
| Name | Pomalidomide-C5-Dovitinib |
|---|
| Description | Pomalidomide-C5-Dovitinib (compound 2) is a PROTAC containing Pomalidomide, Dovitinib and connected with CRBN. Pomalidomide-C5-Dovitinib shows enhanced antiproliferative effects against FLT3-ITD+ AML cells. Pomalidomide-C5-Dovitinib induces the degradation of the FLT3-ITD and KIT proteins in a ubiquitin-proteasome-dependent manner and completely blocks their downstream signaling pathway. Pomalidomide-C5-Dovitinib has the potential for the research of FLT3-ITD+ acute myeloid leukemia[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H38FN9O6 |
|---|---|
| Molecular Weight | 747.77 |
| InChIKey | LOZMISVXTOAAHE-UHFFFAOYSA-N |
| SMILES | Nc1c(-c2nc3ccc(N4CCN(C(=O)CCCCCNc5cccc6c5C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)cc3[nH]2)c(=O)[nH]c2cccc(F)c12 |