1-(4,4'-dichlorobenzhydryl)piperazine structure
|
Common Name | 1-(4,4'-dichlorobenzhydryl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 27469-61-0 | Molecular Weight | 321.24400 | |
| Density | 1.237g/cm3 | Boiling Point | 425.4ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl2N2 | Melting Point | 107ºC | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 1-[bis(4-chlorophenyl)methyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 425.4ºC at 760 mmHg |
| Melting Point | 107ºC |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.24400 |
| Flash Point | 211.1ºC |
| Exact Mass | 320.08500 |
| PSA | 15.27000 |
| LogP | 4.25470 |
| Vapour Pressure | 1.91E-07mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | PTLFMGDNZYQISN-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)N2CCNCC2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4'-Dichlorobenzhydrylpiperazine |
| 1-(4,4'-Dichlorobenzhydryl)piperazine |
| 1-<bis(4-chlorophenyl)methyl>piperazine |
| MFCD00191212 |
| 4-(bis(4-chlorophenyl)methyl)piperazine |