Benzeneacetonitrile, a-(3-chloropropyl)-3,4-dimethoxy-a-(1-methylethyl)- structure
|
Common Name | Benzeneacetonitrile, a-(3-chloropropyl)-3,4-dimethoxy-a-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 27487-83-8 | Molecular Weight | 295.80400 | |
| Density | 1.074g/cm3 | Boiling Point | 417.9ºC at 760 mmHg | |
| Molecular Formula | C16H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5ºC | |
| Name | 5-chloro-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 417.9ºC at 760 mmHg |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.80400 |
| Flash Point | 206.5ºC |
| Exact Mass | 295.13400 |
| PSA | 42.25000 |
| LogP | 4.14018 |
| Vapour Pressure | 3.41E-07mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | VDQLTWSIHIWIFQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C#N)(CCCCl)C(C)C)cc1OC |
| HS Code | 2926909090 |
|---|
|
~95%
Benzeneacetonit... CAS#:27487-83-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 25, # 4 p. 351 - 359 |
|
~79%
Benzeneacetonit... CAS#:27487-83-8 |
| Literature: US5910601 A1, ; |
|
~%
Benzeneacetonit... CAS#:27487-83-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 25, # 4 p. 351 - 359 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(3,4-dimethoxyphenyl)-2-isopropyl-2-(3-chloropropyl)acetonitrile |
| (dimethoxy-3,4 phenyl)-2 (chloro-3 propyl)-2 isovaleronitrile |
| 5-chloro-2-(3,4-dimethoxyphenyl)-2-isopropylvaleronitrile |
| 5-Chloro-2-(3.4-dimethoxyphenyl)-2-isopropylpentanenitrile |
| 2-(3,4-dimethoxyphenyl)-2-isopropyl-5-chloro-pentanenitrile |