rac D 617 (Verapamil Metabolite) structure
|
Common Name | rac D 617 (Verapamil Metabolite) | ||
|---|---|---|---|---|
| CAS Number | 34245-14-2 | Molecular Weight | 290.40100 | |
| Density | 1.004g/cm3 | Boiling Point | 429.1ºC at 760mmHg | |
| Molecular Formula | C17H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | d617 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760mmHg |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.40100 |
| Flash Point | 213.3ºC |
| Exact Mass | 290.19900 |
| PSA | 54.28000 |
| LogP | 3.51168 |
| Index of Refraction | 1.496 |
| InChIKey | WLOBUUJURNEQCL-UHFFFAOYSA-N |
| SMILES | CNCCCC(C#N)(c1ccc(OC)c(OC)c1)C(C)C |
| HS Code | 2926909090 |
|---|
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: TP_TRANSPORTER: transepithelial transport (basal to apical) in MDR1-expressing LLC-PK...
Source: ChEMBL
Target: ATP-dependent translocase ABCB1
External Id: CHEMBL2076279
|
| (R)-(+)-5-N-Methylamino-2-(1-methylethyl)-2-(3,4-dimethoxyphenyl)-pentanenitrile |
| (dimethoxy-3,4 phenyl)-2 (N-methyl amino-3 propyl)-2 isovaleronitrile |
| 2-(3,4-dimethoxyphenyl)-5-methylamino-2-isopropylvaleronitrile |
| 2-(3,4-dimethoxyphenyl)-5-(methylamino)-2-propan-2-ylpentanenitrile |
| rac D 617 (Verapamil Metabolite) |
| 4-cyano-4-(3,4-dimethoxyphenyl)-5,N-dimethyl-hexylamine |