DX3-235 structure
|
Common Name | DX3-235 | ||
|---|---|---|---|---|
| CAS Number | 2749555-39-1 | Molecular Weight | 581.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H39N5O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DX3-235DX3-235 is an oxidative phosphorylation (OXPHOS) inhibitor. DX3-235 shows nanomolar inhibition of complex I function and ATP production in a galactose-containing medium resulting in significant cytotoxicity[1]. |
| Name | DX3-235 |
|---|
| Description | DX3-235 is an oxidative phosphorylation (OXPHOS) inhibitor. DX3-235 shows nanomolar inhibition of complex I function and ATP production in a galactose-containing medium resulting in significant cytotoxicity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H39N5O6S2 |
|---|---|
| Molecular Weight | 581.75 |
| InChIKey | UFKYDDBMWHWQPP-HXUWFJFHSA-N |
| SMILES | CCC(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2CCCC(C(=O)N3CCN(c4nc(C(C)C)no4)CC3)C2)cc1 |