Baccatin III structure
|
Common Name | Baccatin III | ||
|---|---|---|---|---|
| CAS Number | 27548-93-2 | Molecular Weight | 586.627 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 713.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C31H38O11 | Melting Point | 229-234 °C | |
| MSDS | N/A | Flash Point | 226.9±26.4 °C | |
Use of Baccatin IIIBaccatin III is a natural product isolated from Pacific yew tree and related species. Baccatin III reduces tumor progression by inhibiting the accumulation and suppressive function of MDSCs[1]. |
| Name | Baccatine III |
|---|---|
| Synonym | More Synonyms |
| Description | Baccatin III is a natural product isolated from Pacific yew tree and related species. Baccatin III reduces tumor progression by inhibiting the accumulation and suppressive function of MDSCs[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 713.6±60.0 °C at 760 mmHg |
| Melting Point | 229-234 °C |
| Molecular Formula | C31H38O11 |
| Molecular Weight | 586.627 |
| Flash Point | 226.9±26.4 °C |
| Exact Mass | 586.241394 |
| PSA | 165.89000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | OVMSOCFBDVBLFW-VHLOTGQHSA-N |
| SMILES | CC(=O)OC1C(=O)C2(C)C(O)CC3OCC3(OC(C)=O)C2C(OC(=O)c2ccccc2)C2(O)CC(O)C(C)=C1C2(C)C |
| Storage condition | 2-8°C |
| Stability | 4 Year Shelf Life |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R45 |
| Safety Phrases | 53-22-26-36/37/39-45-24/25 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Precursor 7 | |
|---|---|
| DownStream 8 | |
| Baccatin III |
| MFCD00153921 |
| (2α,5β,7β,10β,13α)-4,10-Diacetoxy-1,7,13-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| 7,11-Methano-5H-cyclodeca[3,4]benz[1,2-b]oxet-5-one, 6,12b-bis(acetyloxy)-12-(benzoyloxy)-1,2a,3,4,4a,6,9,10,11,12,12a,12b-dodecahydro-4,9,11-trihydroxy-4a,8,13,13-tetramethyl-, (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)- |