Glu(OtBu)-Val-Cit-PAB-OH structure
|
Common Name | Glu(OtBu)-Val-Cit-PAB-OH | ||
|---|---|---|---|---|
| CAS Number | 2757059-05-3 | Molecular Weight | 564.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H44N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glu(OtBu)-Val-Cit-PAB-OHGlu(OtBu)-Val-Cit-PAB-OH (compound L5-1c) is an non-cleavable ADC linker. Glu(OtBu)-Val-Cit-PAB-OH has been used to synthesis protein-tubulysin conjugates[1]. |
| Name | Glu(OtBu)-Val-Cit-PAB-OH |
|---|
| Description | Glu(OtBu)-Val-Cit-PAB-OH (compound L5-1c) is an non-cleavable ADC linker. Glu(OtBu)-Val-Cit-PAB-OH has been used to synthesis protein-tubulysin conjugates[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Amy Han. Tubulysins and protein-tubulysin conjugates. WO2021262910A2 |
| Molecular Formula | C27H44N6O7 |
|---|---|
| Molecular Weight | 564.67 |
| InChIKey | HPZRSLCEFXXOIR-ONTIZHBOSA-N |
| SMILES | CC(C)C(NC(=O)C(N)CCC(=O)OC(C)(C)C)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |