(4-nitrophenyl) 2-oxopropanoate structure
|
Common Name | (4-nitrophenyl) 2-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 27633-20-1 | Molecular Weight | 209.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 2-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7NO5 |
|---|---|
| Molecular Weight | 209.15600 |
| Exact Mass | 209.03200 |
| PSA | 89.19000 |
| LogP | 1.61240 |
| InChIKey | GESXRWPLNGTJEW-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
(4-nitrophenyl)... CAS#:27633-20-1 |
| Literature: Corey; Sachdev; Gougoutas; Saenger Journal of the American Chemical Society, 1970 , vol. 92, # 8 p. 2488 - 2501 |
|
~%
(4-nitrophenyl)... CAS#:27633-20-1 |
| Literature: Hausler; Schmidt Chemische Berichte, 1974 , vol. 107, # 1 p. 145 - 151 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Brenztraubensaeure-p-nitrophenylester |
| Propanoic acid,2-oxo-,4-nitrophenyl ester |
| 2-oxo-propionic acid 4-nitro-phenyl ester |
| p-Nitrophenyl pyruvat |