Z-Ala-Phe-OH structure
|
Common Name | Z-Ala-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 2768-53-8 | Molecular Weight | 370.39900 | |
| Density | 1.253 g/cm3 | Boiling Point | 643.7ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.1ºC | |
| Name | 3-phenyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253 g/cm3 |
|---|---|
| Boiling Point | 643.7ºC at 760 mmHg |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.39900 |
| Flash Point | 343.1ºC |
| Exact Mass | 370.15300 |
| PSA | 104.73000 |
| LogP | 2.89520 |
| Vapour Pressure | 1.9E-17mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | BVNXQVWGWUHKMK-YOEHRIQHSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| Storage condition | -20°C |
| HS Code | 2924299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyloxycarbonyl-L-alanyl-L-phenylalanine |
| N-Cbz-L-Ala-L-PheOH |
| Z-Ala-Phe-OH |
| Cbz-L-Ala-L-Phe-OH |