Z-L-Ala-L-Phe-Ome structure
|
Common Name | Z-L-Ala-L-Phe-Ome | ||
|---|---|---|---|---|
| CAS Number | 3235-14-1 | Molecular Weight | 384.42600 | |
| Density | 1.197g/cm3 | Boiling Point | 597ºC at 760mmHg | |
| Molecular Formula | C21H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.9ºC | |
| Name | Z-L-Ala-L-Phe-Ome |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 597ºC at 760mmHg |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.42600 |
| Flash Point | 314.9ºC |
| Exact Mass | 384.16900 |
| PSA | 93.73000 |
| LogP | 2.98360 |
| Index of Refraction | 1.557 |
| InChIKey | SIHNOQQFBTTYLO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(C)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| CBZ-Ala-Phe-OMe |
| N-benzyloxycarbonylated methyl ester of L-alanyl-L-phenylalanine |
| N-Z-Ala-Phe-OMe |
| Cbz-Ala-Phe-OCH3 |
| Z-(S)-Ala-(S)-Phe-Ome |
| Z-Ala-Phe-OMe |