2-[(3-Sulfophenyl)amino]benzoic acid structure
|
Common Name | 2-[(3-Sulfophenyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 27696-27-1 | Molecular Weight | 293.29500 | |
| Density | 1.537g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-sulfoanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.537g/cm3 |
|---|---|
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.29500 |
| Exact Mass | 293.03600 |
| PSA | 112.08000 |
| LogP | 3.52890 |
| Index of Refraction | 1.675 |
| InChIKey | FNAKUEGSLRUPTF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cccc(S(=O)(=O)O)c1 |
| HS Code | 2922499990 |
|---|
|
~%
2-[(3-Sulfophen... CAS#:27696-27-1 |
| Literature: Hoechster Farbw. Patent: DE146102 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-(2-Carboxyanilino)benzenesulfonic acid |
| Diphenylamin-carbonsaeure-(2)-sulfonsaeure-(3') |
| N-(3-sulfo-phenyl)-anthranilic acid |
| N-(3-Sulfo-phenyl)-anthranilsaeure |
| 2-[(3-sulfophenyl)amino]benzoic acid |
| Benzenesulfonic acid,3-(2-carboxyanilino) |
| Anthranilic acid,N-m-sulfophenyl |