2-[(3-ethylphenyl)amino]benzoic acid structure
|
Common Name | 2-[(3-ethylphenyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5349-00-8 | Molecular Weight | 241.28500 | |
| Density | 1.201g/cm3 | Boiling Point | 399.1ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 2-(3-ethylanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 399.1ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 195.2ºC |
| Exact Mass | 241.11000 |
| PSA | 49.33000 |
| LogP | 3.76380 |
| Index of Refraction | 1.637 |
| InChIKey | ZTLAQZXMUUKFOV-UHFFFAOYSA-N |
| SMILES | CCc1cccc(Nc2ccccc2C(=O)O)c1 |
|
~%
2-[(3-ethylphen... CAS#:5349-00-8 |
| Literature: Kaltenbronn; Scherrer; Short; Jones; Beatty; Saka; Winder; Wax; Williamson Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 4 A p. 621 - 627 |
|
~%
2-[(3-ethylphen... CAS#:5349-00-8 |
| Literature: Sargent Journal of Organic Chemistry, 1954 , vol. 19, p. 599,604 |
|
~%
2-[(3-ethylphen... CAS#:5349-00-8 |
| Literature: Sargent Journal of Organic Chemistry, 1954 , vol. 19, p. 599,604 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(3-Aethyl-phenyl)-anthranilsaeure |
| 2-[(3-ethylphenyl)amino]benzoic acid |
| N-(3-ethyl-phenyl)-anthranilic acid |